C11H18N2O3 — CID 66517496
(1S)-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine (PubChem CID 66517496) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (1S)-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517496 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (1S)-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(OC)c([C@H](N)CN)cc1OC |
| InChI | InChI=1S/C11H18N2O3/c1-14-9-5-11(16-3)10(15-2)4-7(9)8(13)6-12/h4-5,8H,6,12-13H2,1-3H3/t8-/m1/s1 |
| InChIKey | HWQFWIQNXIJJNJ-MRVPVSSYSA-N |
| XLogP | 0.67 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |