C11H17NO4 — CID 28743465
(1R)-2-amino-1-(2,4,5-trimethoxyphenyl)ethanol (PubChem CID 28743465) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (1R)-2-amino-1-(2,4,5-trimethoxyphenyl)ethanol.
| Compound Name | (1R)-2-amino-1-(2,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 28743465 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (1R)-2-amino-1-(2,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(OC)c([C@@H](O)CN)cc1OC |
| InChI | InChI=1S/C11H17NO4/c1-14-9-5-11(16-3)10(15-2)4-7(9)8(13)6-12/h4-5,8,13H,6,12H2,1-3H3/t8-/m0/s1 |
| InChIKey | OJIBCXRMXJZCTR-QMMMGPOBSA-N |
| XLogP | 0.70 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |