C11H17NO5S — CID 117440336
2-amino-1-(4,5-dimethoxy-2-methylsulfonylphenyl)ethanol (PubChem CID 117440336) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-amino-1-(4,5-dimethoxy-2-methylsulfonylphenyl)ethanol.
| Compound Name | 2-amino-1-(4,5-dimethoxy-2-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 117440336 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-amino-1-(4,5-dimethoxy-2-methylsulfonylphenyl)ethanol |
| SMILES | COc1cc(C(O)CN)c(S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C11H17NO5S/c1-16-9-4-7(8(13)6-12)11(18(3,14)15)5-10(9)17-2/h4-5,8,13H,6,12H2,1-3H3 |
| InChIKey | KHWLVWFGMKIZOT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |