C10H15NO5S — CID 116939710
amino-(2,5-dimethoxy-4-methylsulfonylphenyl)methanol (PubChem CID 116939710) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is amino-(2,5-dimethoxy-4-methylsulfonylphenyl)methanol.
| Compound Name | amino-(2,5-dimethoxy-4-methylsulfonylphenyl)methanol |
|---|---|
| PubChem CID | 116939710 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | amino-(2,5-dimethoxy-4-methylsulfonylphenyl)methanol |
| SMILES | COc1cc(S(C)(=O)=O)c(OC)cc1C(N)O |
| InChI | InChI=1S/C10H15NO5S/c1-15-7-5-9(17(3,13)14)8(16-2)4-6(7)10(11)12/h4-5,10,12H,11H2,1-3H3 |
| InChIKey | WEZFRBHQOPYAEI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|