C9H13NO3 — CID 116939586
amino-(2,5-dimethoxyphenyl)methanol (PubChem CID 116939586) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is amino-(2,5-dimethoxyphenyl)methanol.
| Compound Name | amino-(2,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 116939586 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | amino-(2,5-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(OC)c(C(N)O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5,9,11H,10H2,1-2H3 |
| InChIKey | UASXAHCEPRNATE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|