C14H23NO3 — CID 171162385
(1S,2R)-1-amino-1-(2,5-dimethoxyphenyl)-3,3-dimethylbutan-2-ol (PubChem CID 171162385) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,5-dimethoxyphenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,5-dimethoxyphenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 171162385 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,5-dimethoxyphenyl)-3,3-dimethylbutan-2-ol |
| SMILES | COc1ccc(OC)c([C@H](N)[C@H](O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H23NO3/c1-14(2,3)13(16)12(15)10-8-9(17-4)6-7-11(10)18-5/h6-8,12-13,16H,15H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | XLORMQGKMGLYQZ-STQMWFEESA-N |
| XLogP | 2.11 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |