C13H21NO3 — CID 171267542
2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-methoxyphenol (PubChem CID 171267542) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-methoxyphenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 171267542 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c([C@H](N)[C@H](O)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)12(16)11(14)9-7-8(17-4)5-6-10(9)15/h5-7,11-12,15-16H,14H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | NSNAJQMNMYKSNG-RYUDHWBXSA-N |
| XLogP | 1.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|