C13H19NO3 — CID 171267534
2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-methoxyphenol (PubChem CID 171267534) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-methoxyphenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 171267534 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c([C@H](N)[C@H](O)C2CCC2)c1 |
| InChI | InChI=1S/C13H19NO3/c1-17-9-5-6-11(15)10(7-9)12(14)13(16)8-3-2-4-8/h5-8,12-13,15-16H,2-4,14H2,1H3/t12-,13+/m0/s1 |
| InChIKey | JNTKOWQJBDHHPV-QWHCGFSZSA-N |
| XLogP | 1.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|