C14H21NO3 — CID 171161039
(1S,2R)-2-amino-1-cyclobutyl-2-(2,4-dimethoxyphenyl)ethanol (PubChem CID 171161039) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclobutyl-2-(2,4-dimethoxyphenyl)ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclobutyl-2-(2,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 171161039 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclobutyl-2-(2,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc([C@@H](N)[C@@H](O)C2CCC2)c(OC)c1 |
| InChI | InChI=1S/C14H21NO3/c1-17-10-6-7-11(12(8-10)18-2)13(15)14(16)9-4-3-5-9/h6-9,13-14,16H,3-5,15H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | LNTAAENHRNGUNI-KGLIPLIRSA-N |
| XLogP | 1.86 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |