C10H14O4 — CID 51666215
(1R)-1-(2,5-dimethoxyphenyl)ethane-1,2-diol (PubChem CID 51666215) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1R)-1-(2,5-dimethoxyphenyl)ethane-1,2-diol.
| Compound Name | (1R)-1-(2,5-dimethoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 51666215 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1R)-1-(2,5-dimethoxyphenyl)ethane-1,2-diol |
| SMILES | COc1ccc(OC)c([C@@H](O)CO)c1 |
| InChI | InChI=1S/C10H14O4/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5,9,11-12H,6H2,1-2H3/t9-/m0/s1 |
| InChIKey | VNNWBKGUIXDGLA-VIFPVBQESA-N |
| XLogP | 0.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |