C16H27NO4 — CID 107851809
6-[[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]amino]hexan-1-ol (PubChem CID 107851809) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is 6-[[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]amino]hexan-1-ol.
| Compound Name | 6-[[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 107851809 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 6-[[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]amino]hexan-1-ol |
| SMILES | COc1ccc(OC)c(C(O)CNCCCCCCO)c1 |
| InChI | InChI=1S/C16H27NO4/c1-20-13-7-8-16(21-2)14(11-13)15(19)12-17-9-5-3-4-6-10-18/h7-8,11,15,17-19H,3-6,9-10,12H2,1-2H3 |
| InChIKey | AGGRTLJPQAIYFX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|