C12H16BrNO4 — CID 139669776
2-bromo-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide (PubChem CID 139669776) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-bromo-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide.
| Compound Name | 2-bromo-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide |
|---|---|
| PubChem CID | 139669776 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2-bromo-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide |
| SMILES | COc1ccc(OC)c(C(O)CNC(=O)CBr)c1 |
| InChI | InChI=1S/C12H16BrNO4/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13/h3-5,10,15H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | LYCUMASAKVKZEA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|