C15H25N3O3 — CID 75420917
1-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methyl-3-propylguanidine (PubChem CID 75420917) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methyl-3-propylguanidine.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methyl-3-propylguanidine |
|---|---|
| PubChem CID | 75420917 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methyl-3-propylguanidine |
| SMILES | CCCN/C(=N\C)NCC(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H25N3O3/c1-5-8-17-15(16-2)18-10-13(19)12-9-11(20-3)6-7-14(12)21-4/h6-7,9,13,19H,5,8,10H2,1-4H3,(H2,16,17,18) |
| InChIKey | PZIHFVIHRYWYOS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|