C20H35N3O4 — CID 111239697
1-(3-butoxypropyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine (PubChem CID 111239697) has the molecular formula C20H35N3O4 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine.
| Compound Name | 1-(3-butoxypropyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111239697 |
| Molecular Formula | C20H35N3O4 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 1-(3-butoxypropyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine |
| SMILES | CCCCOCCCN/C(=N/CC(O)c1cc(OC)ccc1OC)NCC |
| InChI | InChI=1S/C20H35N3O4/c1-5-7-12-27-13-8-11-22-20(21-6-2)23-15-18(24)17-14-16(25-3)9-10-19(17)26-4/h9-10,14,18,24H,5-8,11-13,15H2,1-4H3,(H2,21,22,23) |
| InChIKey | IWWXLAWQBSXSJN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|