C22H31FIN3O4 — CID 111988074
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine;hydroiodide (PubChem CID 111988074) has the molecular formula C22H31FIN3O4 and a molecular weight of 547.41 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111988074 |
| Molecular Formula | C22H31FIN3O4 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-fluorophenoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NCC(C)Oc1ccc(F)cc1.I |
| InChI | InChI=1S/C22H30FN3O4.HI/c1-5-24-22(25-13-15(2)30-17-8-6-16(23)7-9-17)26-14-20(27)19-12-18(28-3)10-11-21(19)29-4;/h6-12,15,20,27H,5,13-14H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | ZDDYCPDQZYQYJS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|