C23H34IN3O5 — CID 111988238
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide (PubChem CID 111988238) has the molecular formula C23H34IN3O5 and a molecular weight of 559.45 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111988238 |
| Molecular Formula | C23H34IN3O5 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NCC(C)Oc1ccccc1OC.I |
| InChI | InChI=1S/C23H33N3O5.HI/c1-6-24-23(25-14-16(2)31-22-10-8-7-9-21(22)30-5)26-15-19(27)18-13-17(28-3)11-12-20(18)29-4;/h7-13,16,19,27H,6,14-15H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | YHSIVTAMZPBVCP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|