C23H33N3O5 — CID 111378326
1-[1-(2,5-dimethoxyphenyl)ethyl]-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine (PubChem CID 111378326) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[1-(2,5-dimethoxyphenyl)ethyl]-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine.
| Compound Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111378326 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NC(C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C23H33N3O5/c1-7-24-23(26-15(2)18-12-16(28-3)8-10-21(18)30-5)25-14-20(27)19-13-17(29-4)9-11-22(19)31-6/h8-13,15,20,27H,7,14H2,1-6H3,(H2,24,25,26) |
| InChIKey | SHKNXAZTFSRWAL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|