C16H25F3IN3O2 — CID 111984948
1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111984948) has the molecular formula C16H25F3IN3O2 and a molecular weight of 475.29 g/mol. Its IUPAC name is 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111984948 |
| Molecular Formula | C16H25F3IN3O2 |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)NC(C)c1cc(OC)ccc1OC.I |
| InChI | InChI=1S/C16H24F3N3O2.HI/c1-5-20-15(21-9-8-16(17,18)19)22-11(2)13-10-12(23-3)6-7-14(13)24-4;/h6-7,10-11H,5,8-9H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | NUSKUIWDHUOFCB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|