C22H32IN3O3 — CID 111378337
1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111378337) has the molecular formula C22H32IN3O3 and a molecular weight of 513.42 g/mol. Its IUPAC name is 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111378337 |
| Molecular Formula | C22H32IN3O3 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)Cc1ccccc1)NC(C)c1cc(OC)ccc1OC.I |
| InChI | InChI=1S/C22H31N3O3.HI/c1-5-23-22(24-15-18(26)13-17-9-7-6-8-10-17)25-16(2)20-14-19(27-3)11-12-21(20)28-4;/h6-12,14,16,18,26H,5,13,15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | GRGGQWMGAWUMQN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|