C20H36IN3O3 — CID 111386329
1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111386329) has the molecular formula C20H36IN3O3 and a molecular weight of 493.43 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111386329 |
| Molecular Formula | C20H36IN3O3 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COCC(C)C)NC(C)c1cc(C)ccc1OC.I |
| InChI | InChI=1S/C20H35N3O3.HI/c1-7-21-20(22-11-17(24)13-26-12-14(2)3)23-16(5)18-10-15(4)8-9-19(18)25-6;/h8-10,14,16-17,24H,7,11-13H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | MJECKWRUZBGXHQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|