C22H33N3O2 — CID 111321784
1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(1-naphthalen-2-ylethyl)guanidine (PubChem CID 111321784) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(1-naphthalen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(1-naphthalen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111321784 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(1-naphthalen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(O)COCC(C)C)NC(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H33N3O2/c1-5-23-22(24-13-21(26)15-27-14-16(2)3)25-17(4)19-11-10-18-8-6-7-9-20(18)12-19/h6-12,16-17,21,26H,5,13-15H2,1-4H3,(H2,23,24,25) |
| InChIKey | UDRLLPWZDYUINC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|