C13H26F3N3O2 — CID 109471203
1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471203) has the molecular formula C13H26F3N3O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471203 |
| Molecular Formula | C13H26F3N3O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(O)COCC(C)C)NCCC(F)(F)F |
| InChI | InChI=1S/C13H26F3N3O2/c1-4-17-12(18-6-5-13(14,15)16)19-7-11(20)9-21-8-10(2)3/h10-11,20H,4-9H2,1-3H3,(H2,17,18,19) |
| InChIKey | JESDRJFYLLTXTC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|