C16H25F3IN3O — CID 109472590
1-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472590) has the molecular formula C16H25F3IN3O and a molecular weight of 459.29 g/mol. Its IUPAC name is 1-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472590 |
| Molecular Formula | C16H25F3IN3O |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 1-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC(C)C)cc1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C16H24F3N3O.HI/c1-4-20-15(21-10-9-16(17,18)19)22-11-13-5-7-14(8-6-13)23-12(2)3;/h5-8,12H,4,9-11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | SUUNOCMDDNWPFW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|