C21H37N3O2 — CID 111716614
1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine (PubChem CID 111716614) has the molecular formula C21H37N3O2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111716614 |
| Molecular Formula | C21H37N3O2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC(C)C)cc1)NCC(CC)(CC)CCO |
| InChI | InChI=1S/C21H37N3O2/c1-6-21(7-2,13-14-25)16-24-20(22-8-3)23-15-18-9-11-19(12-10-18)26-17(4)5/h9-12,17,25H,6-8,13-16H2,1-5H3,(H2,22,23,24) |
| InChIKey | PHJVMDPRZUSGHR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|