C22H40N4O3S — CID 111716574
1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111716574) has the molecular formula C22H40N4O3S and a molecular weight of 440.65 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111716574 |
| Molecular Formula | C22H40N4O3S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC(C)C)cc1)NCC(CC)(CC)CCO |
| InChI | InChI=1S/C22H40N4O3S/c1-6-22(7-2,13-14-27)17-25-21(23-8-3)24-15-19-9-11-20(12-10-19)16-30(28,29)26-18(4)5/h9-12,18,26-27H,6-8,13-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | XNACEWJVNOUEFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|