C22H38N4O3S — CID 111716270
1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111716270) has the molecular formula C22H38N4O3S and a molecular weight of 438.64 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111716270 |
| Molecular Formula | C22H38N4O3S |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCC2)cc1)NCC(CC)(CC)CCO |
| InChI | InChI=1S/C22H38N4O3S/c1-4-22(5-2,13-16-27)18-25-21(23-6-3)24-17-19-9-11-20(12-10-19)30(28,29)26-14-7-8-15-26/h9-12,27H,4-8,13-18H2,1-3H3,(H2,23,24,25) |
| InChIKey | YRJQFPWDAMCFRD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|