C21H38IN3O2 — CID 111716613
1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111716613) has the molecular formula C21H38IN3O2 and a molecular weight of 491.46 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111716613 |
| Molecular Formula | C21H38IN3O2 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[(4-propan-2-yloxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC(C)C)cc1)NCC(CC)(CC)CCO.I |
| InChI | InChI=1S/C21H37N3O2.HI/c1-6-21(7-2,13-14-25)16-24-20(22-8-3)23-15-18-9-11-19(12-10-18)26-17(4)5;/h9-12,17,25H,6-8,13-16H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | YZHGVDGHZLYCQR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|