C15H22F3IN4O — CID 109472168
4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 109472168) has the molecular formula C15H22F3IN4O and a molecular weight of 458.27 g/mol. Its IUPAC name is 4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 109472168 |
| Molecular Formula | C15H22F3IN4O |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC)cc1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H21F3N4O.HI/c1-3-20-14(21-9-8-15(16,17)18)22-10-11-4-6-12(7-5-11)13(23)19-2;/h4-7H,3,8-10H2,1-2H3,(H,19,23)(H2,20,21,22);1H |
| InChIKey | YPLXJQFZMKUDIM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|