C21H28N4O — CID 111635752
4-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 111635752) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111635752 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 4-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC)cc1)NCc1ccccc1CC |
| InChI | InChI=1S/C21H28N4O/c1-4-17-8-6-7-9-19(17)15-25-21(23-5-2)24-14-16-10-12-18(13-11-16)20(26)22-3/h6-13H,4-5,14-15H2,1-3H3,(H,22,26)(H2,23,24,25) |
| InChIKey | WHQKTPFQVBVSKW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|