C20H24FN5O2 — CID 111264797
N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-fluorophenyl)methylamino]methylidene]amino]methyl]benzamide (PubChem CID 111264797) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-fluorophenyl)methylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-fluorophenyl)methylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111264797 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-fluorophenyl)methylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NCc1ccccc1F |
| InChI | InChI=1S/C20H24FN5O2/c1-2-23-20(26-12-16-5-3-4-6-17(16)21)25-11-14-7-9-15(10-8-14)19(28)24-13-18(22)27/h3-10H,2,11-13H2,1H3,(H2,22,27)(H,24,28)(H2,23,25,26) |
| InChIKey | QMXOVCJMHPHLTF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|