C19H26IN5O2S — CID 111898456
N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111898456) has the molecular formula C19H26IN5O2S and a molecular weight of 515.42 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111898456 |
| Molecular Formula | C19H26IN5O2S |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C19H25N5O2S.HI/c1-3-21-19(24-11-16-9-4-13(2)27-16)23-10-14-5-7-15(8-6-14)18(26)22-12-17(20)25;/h4-9H,3,10-12H2,1-2H3,(H2,20,25)(H,22,26)(H2,21,23,24);1H |
| InChIKey | JLYUUZRGHIUGCA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|