C19H26IN3O2S — CID 111899008
ethyl 4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 111899008) has the molecular formula C19H26IN3O2S and a molecular weight of 487.41 g/mol. Its IUPAC name is ethyl 4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | ethyl 4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111899008 |
| Molecular Formula | C19H26IN3O2S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | ethyl 4-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)OCC)cc1)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C19H25N3O2S.HI/c1-4-20-19(22-13-17-11-6-14(3)25-17)21-12-15-7-9-16(10-8-15)18(23)24-5-2;/h6-11H,4-5,12-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | INCVWRFBBJGBLT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|