C20H30IN3O3S — CID 111897524
2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111897524) has the molecular formula C20H30IN3O3S and a molecular weight of 519.45 g/mol. Its IUPAC name is 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111897524 |
| Molecular Formula | C20H30IN3O3S |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OCC)c(OC)c1)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C20H29N3O3S.HI/c1-6-21-20(23-13-16-9-8-14(3)27-16)22-12-15-10-17(24-4)19(26-7-2)18(11-15)25-5;/h8-11H,6-7,12-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | VYEUOQVYFJJZII-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|