C22H30FN3O3 — CID 111846767
2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]guanidine (PubChem CID 111846767) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]guanidine.
| Compound Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111846767 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OCC)c(OC)c1)NCc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C22H30FN3O3/c1-6-24-22(25-13-16-9-8-15(3)18(23)10-16)26-14-17-11-19(27-4)21(29-7-2)20(12-17)28-5/h8-12H,6-7,13-14H2,1-5H3,(H2,24,25,26) |
| InChIKey | ITJURKPOFBYPKB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|