C15H24ClN3O2 — CID 110925925
2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1,3-diethylguanidine (PubChem CID 110925925) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1,3-diethylguanidine.
| Compound Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 110925925 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCc1cc(Cl)c(OCC)c(OC)c1)NCC |
| InChI | InChI=1S/C15H24ClN3O2/c1-5-17-15(18-6-2)19-10-11-8-12(16)14(21-7-3)13(9-11)20-4/h8-9H,5-7,10H2,1-4H3,(H2,17,18,19) |
| InChIKey | CCVFYQQNSORAQM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|