C21H36ClIN4O3 — CID 111315601
2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111315601) has the molecular formula C21H36ClIN4O3 and a molecular weight of 554.90 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111315601 |
| Molecular Formula | C21H36ClIN4O3 |
| Molecular Weight | 554.90 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)NCC(C)(C)N1CCOCC1.I |
| InChI | InChI=1S/C21H35ClN4O3.HI/c1-6-23-20(25-15-21(3,4)26-8-10-28-11-9-26)24-14-16-12-17(22)19(29-7-2)18(13-16)27-5;/h12-13H,6-11,14-15H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | PFDTXGNHERYQDR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|