C21H33ClN4O3 — CID 111313446
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111313446) has the molecular formula C21H33ClN4O3 and a molecular weight of 424.97 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111313446 |
| Molecular Formula | C21H33ClN4O3 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)c2c(c1)OCCCO2)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C21H33ClN4O3/c1-4-23-20(25-15-21(2,3)26-6-10-27-11-7-26)24-14-16-12-17(22)19-18(13-16)28-8-5-9-29-19/h12-13H,4-11,14-15H2,1-3H3,(H2,23,24,25) |
| InChIKey | WYEISPILPDIBHT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|