C17H24ClN3O2 — CID 111386270
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(cyclopropylmethyl)-3-ethylguanidine (PubChem CID 111386270) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(cyclopropylmethyl)-3-ethylguanidine.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(cyclopropylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111386270 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(cyclopropylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)c2c(c1)OCCCO2)NCC1CC1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-2-19-17(20-10-12-4-5-12)21-11-13-8-14(18)16-15(9-13)22-6-3-7-23-16/h8-9,12H,2-7,10-11H2,1H3,(H2,19,20,21) |
| InChIKey | AYZIUOJBVLUAGQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|