C18H23ClIN3O2S — CID 111386220
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111386220) has the molecular formula C18H23ClIN3O2S and a molecular weight of 507.83 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111386220 |
| Molecular Formula | C18H23ClIN3O2S |
| Molecular Weight | 507.83 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-ethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c2c(c1)OCCCO2)NCc1ccsc1.I |
| InChI | InChI=1S/C18H22ClN3O2S.HI/c1-2-20-18(21-10-13-4-7-25-12-13)22-11-14-8-15(19)17-16(9-14)23-5-3-6-24-17;/h4,7-9,12H,2-3,5-6,10-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | HVHJZNJVRZDKMH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|