C20H25ClIN3O3 — CID 111216918
2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-[(2-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111216918) has the molecular formula C20H25ClIN3O3 and a molecular weight of 517.80 g/mol. Its IUPAC name is 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-[(2-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111216918 |
| Molecular Formula | C20H25ClIN3O3 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c2c(c1)OCCO2)NCc1ccccc1OC.I |
| InChI | InChI=1S/C20H24ClN3O3.HI/c1-3-22-20(24-13-15-6-4-5-7-17(15)25-2)23-12-14-10-16(21)19-18(11-14)26-8-9-27-19;/h4-7,10-11H,3,8-9,12-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | CBDZOUXYEYTSTG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|