C21H36ClN3O3 — CID 111716016
2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine (PubChem CID 111716016) has the molecular formula C21H36ClN3O3 and a molecular weight of 413.99 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine.
| Compound Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111716016 |
| Molecular Formula | C21H36ClN3O3 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)NCC(CC)(CC)CCO |
| InChI | InChI=1S/C21H36ClN3O3/c1-6-21(7-2,10-11-26)15-25-20(23-8-3)24-14-16-12-17(22)19(28-9-4)18(13-16)27-5/h12-13,26H,6-11,14-15H2,1-5H3,(H2,23,24,25) |
| InChIKey | WDKMOFHNWAKBFK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|