C21H30ClN3O4 — CID 111663305
2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine (PubChem CID 111663305) has the molecular formula C21H30ClN3O4 and a molecular weight of 423.94 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine.
| Compound Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111663305 |
| Molecular Formula | C21H30ClN3O4 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)NCC(C)(O)c1ccc(C)o1 |
| InChI | InChI=1S/C21H30ClN3O4/c1-6-23-20(25-13-21(4,26)18-9-8-14(3)29-18)24-12-15-10-16(22)19(28-7-2)17(11-15)27-5/h8-11,26H,6-7,12-13H2,1-5H3,(H2,23,24,25) |
| InChIKey | ZRWJNKHABPMIQT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|