C20H33ClN4O3 — CID 111021913
2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 111021913) has the molecular formula C20H33ClN4O3 and a molecular weight of 412.96 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111021913 |
| Molecular Formula | C20H33ClN4O3 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)NCC(C)N1CCOCC1 |
| InChI | InChI=1S/C20H33ClN4O3/c1-5-22-20(23-13-15(3)25-7-9-27-10-8-25)24-14-16-11-17(21)19(28-6-2)18(12-16)26-4/h11-12,15H,5-10,13-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | APIODRXTKWWGCZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|