C21H34ClIN4O3 — CID 111728368
N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111728368) has the molecular formula C21H34ClIN4O3 and a molecular weight of 552.89 g/mol. Its IUPAC name is N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111728368 |
| Molecular Formula | C21H34ClIN4O3 |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)N1CCC(N2CCOCC2)C1.I |
| InChI | InChI=1S/C21H33ClN4O3.HI/c1-4-23-21(26-7-6-17(15-26)25-8-10-28-11-9-25)24-14-16-12-18(22)20(29-5-2)19(13-16)27-3;/h12-13,17H,4-11,14-15H2,1-3H3,(H,23,24);1H |
| InChIKey | CGOHVQGXTBZDQO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|