C19H29BrN4O2 — CID 111727277
N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111727277) has the molecular formula C19H29BrN4O2 and a molecular weight of 425.37 g/mol. Its IUPAC name is N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111727277 |
| Molecular Formula | C19H29BrN4O2 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(Br)c1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C19H29BrN4O2/c1-3-21-19(22-13-15-4-5-18(25-2)17(20)12-15)24-7-6-16(14-24)23-8-10-26-11-9-23/h4-5,12,16H,3,6-11,13-14H2,1-2H3,(H,21,22) |
| InChIKey | JOLVCFYHWOOXEO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|