C18H26BrFN4O — CID 111726941
N'-[(4-bromo-3-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111726941) has the molecular formula C18H26BrFN4O and a molecular weight of 413.34 g/mol. Its IUPAC name is N'-[(4-bromo-3-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[(4-bromo-3-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726941 |
| Molecular Formula | C18H26BrFN4O |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N'-[(4-bromo-3-fluorophenyl)methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Br)c(F)c1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C18H26BrFN4O/c1-2-21-18(22-12-14-3-4-16(19)17(20)11-14)24-6-5-15(13-24)23-7-9-25-10-8-23/h3-4,11,15H,2,5-10,12-13H2,1H3,(H,21,22) |
| InChIKey | IZRWFRMQOQNMPQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|