C19H30N4O2 — CID 111726485
N-ethyl-N'-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111726485) has the molecular formula C19H30N4O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726485 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-ethyl-N'-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C19H30N4O2/c1-3-20-19(21-14-16-5-4-6-18(13-16)24-2)23-8-7-17(15-23)22-9-11-25-12-10-22/h4-6,13,17H,3,7-12,14-15H2,1-2H3,(H,20,21) |
| InChIKey | BQWWKGOZPPSUEX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|