C17H26ClN3O3 — CID 111549962
(3R)-N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide (PubChem CID 111549962) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is (3R)-N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111549962 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (3R)-N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C17H26ClN3O3/c1-4-19-17(21-7-6-13(22)11-21)20-10-12-8-14(18)16(24-5-2)15(9-12)23-3/h8-9,13,22H,4-7,10-11H2,1-3H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | UJBOIJQLEBHXLF-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|