C19H29N3O3 — CID 111550560
(3R)-N'-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide (PubChem CID 111550560) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is (3R)-N'-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N'-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111550560 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (3R)-N'-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
| SMILES | C=CCc1cc(C/N=C(\NCC)N2CC[C@@H](O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H29N3O3/c1-5-7-15-10-14(11-17(24-3)18(15)25-4)12-21-19(20-6-2)22-9-8-16(23)13-22/h5,10-11,16,23H,1,6-9,12-13H2,2-4H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | XGJNCPFPNJOZAQ-MRXNPFEDSA-N |
| XLogP | 1.96 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|