C19H25N3O2 — CID 111551146
(3R)-N-ethyl-3-hydroxy-N'-[(6-methoxynaphthalen-2-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111551146) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-[(6-methoxynaphthalen-2-yl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-[(6-methoxynaphthalen-2-yl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111551146 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-[(6-methoxynaphthalen-2-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc2cc(OC)ccc2c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C19H25N3O2/c1-3-20-19(22-9-8-17(23)13-22)21-12-14-4-5-16-11-18(24-2)7-6-15(16)10-14/h4-7,10-11,17,23H,3,8-9,12-13H2,1-2H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | KMMCPNKZDNUQHP-QGZVFWFLSA-N |
| XLogP | 2.38 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|